C35H53NO — CID 99574233
N-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-N-phenylacetamide (PubChem CID 99574233) has the molecular formula C35H53NO and a molecular weight of 503.82 g/mol. Its IUPAC name is N-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-N-phenylacetamide.
| Compound Name | N-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 99574233 |
| Molecular Formula | C35H53NO |
| Molecular Weight | 503.82 g/mol |
| Exact Mass | 503.41 |
| IUPAC Name | N-[(3R,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-N-phenylacetamide |
| SMILES | CC(=O)N(c1ccccc1)[C@@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C35H53NO/c1-24(2)11-10-12-25(3)31-17-18-32-30-16-15-27-23-29(36(26(4)37)28-13-8-7-9-14-28)19-21-34(27,5)33(30)20-22-35(31,32)6/h7-9,13-15,24-25,29-33H,10-12,16-23H2,1-6H3/t25-,29-,30+,31-,32+,33+,34+,35-/m1/s1 |
| InChIKey | GYCJUQNIFQUXTC-UPGPTBJLSA-N |
| XLogP | 9.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.82 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|