C26H32N2O7 — CID 99576945
[(1S,2R,5R,7R,9S,11S,12S,16S)-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] 3,5-dinitrobenzoate (PubChem CID 99576945) has the molecular formula C26H32N2O7 and a molecular weight of 484.55 g/mol. Its IUPAC name is [(1S,2R,5R,7R,9S,11S,12S,16S)-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] 3,5-dinitrobenzoate.
| Compound Name | [(1S,2R,5R,7R,9S,11S,12S,16S)-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 99576945 |
| Molecular Formula | C26H32N2O7 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | [(1S,2R,5R,7R,9S,11S,12S,16S)-2,16-dimethyl-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadecan-5-yl] 3,5-dinitrobenzoate |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1C[C@@H]3O[C@@]34C[C@H](OC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)CC[C@]4(C)[C@H]1CC2 |
| InChI | InChI=1S/C26H32N2O7/c1-24-7-3-4-20(24)19-13-22-26(35-22)14-18(5-9-25(26,2)21(19)6-8-24)34-23(29)15-10-16(27(30)31)12-17(11-15)28(32)33/h10-12,18-22H,3-9,13-14H2,1-2H3/t18-,19+,20+,21+,22+,24+,25-,26+/m1/s1 |
| InChIKey | UHBQQROSQQYOOK-UBBYKTDRSA-N |
| XLogP | 5.59 |
| TPSA | 125.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|