C25H38OS4 — CID 99577198
(8S,9S,10R,11R,13S,14S,17S)-10,13-dimethyl-17-(2-methyl-1,3-dithiolan-2-yl)spiro[1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dithiolane]-11-ol (PubChem CID 99577198) has the molecular formula C25H38OS4 and a molecular weight of 482.85 g/mol. Its IUPAC name is (8S,9S,10R,11R,13S,14S,17S)-10,13-dimethyl-17-(2-methyl-1,3-dithiolan-2-yl)spiro[1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dithiolane]-11-ol.
| Compound Name | (8S,9S,10R,11R,13S,14S,17S)-10,13-dimethyl-17-(2-methyl-1,3-dithiolan-2-yl)spiro[1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dithiolane]-11-ol |
|---|---|
| PubChem CID | 99577198 |
| Molecular Formula | C25H38OS4 |
| Molecular Weight | 482.85 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | (8S,9S,10R,11R,13S,14S,17S)-10,13-dimethyl-17-(2-methyl-1,3-dithiolan-2-yl)spiro[1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dithiolane]-11-ol |
| SMILES | CC1([C@H]2CC[C@H]3[C@@H]4CCC5=CC6(CC[C@]5(C)[C@H]4[C@H](O)C[C@]23C)SCCS6)SCCS1 |
| InChI | InChI=1S/C25H38OS4/c1-22-8-9-25(29-12-13-30-25)14-16(22)4-5-17-18-6-7-20(24(3)27-10-11-28-24)23(18,2)15-19(26)21(17)22/h14,17-21,26H,4-13,15H2,1-3H3/t17-,18-,19+,20-,21+,22-,23-/m0/s1 |
| InChIKey | XJYRXAXQNINNPC-CXJHFUFTSA-N |
| XLogP | 6.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.85 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|