C14H20OS2 — CID 10967523
(1S,8aR)-8a-methylspiro[1,2,3,4,7,8-hexahydronaphthalene-6,2'-1,3-dithiolane]-1-carbaldehyde (PubChem CID 10967523) has the molecular formula C14H20OS2 and a molecular weight of 268.45 g/mol. Its IUPAC name is (1S,8aR)-8a-methylspiro[1,2,3,4,7,8-hexahydronaphthalene-6,2'-1,3-dithiolane]-1-carbaldehyde.
| Compound Name | (1S,8aR)-8a-methylspiro[1,2,3,4,7,8-hexahydronaphthalene-6,2'-1,3-dithiolane]-1-carbaldehyde |
|---|---|
| PubChem CID | 10967523 |
| Molecular Formula | C14H20OS2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (1S,8aR)-8a-methylspiro[1,2,3,4,7,8-hexahydronaphthalene-6,2'-1,3-dithiolane]-1-carbaldehyde |
| SMILES | C[C@]12CCC3(C=C1CCC[C@@H]2C=O)SCCS3 |
| InChI | InChI=1S/C14H20OS2/c1-13-5-6-14(16-7-8-17-14)9-11(13)3-2-4-12(13)10-15/h9-10,12H,2-8H2,1H3/t12-,13+/m1/s1 |
| InChIKey | INWGGQGINNPQFJ-OLZOCXBDSA-N |
| XLogP | 3.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|