C42H44N2O11 — CID 99692523
[(2R,3S,4S,5R)-3,4-dibenzoyloxy-5-[6-methyl-5-[(E)-3-octoxy-3-oxoprop-1-enyl]-2,4-dioxo-1H-pyrimidin-3-yl]oxolan-2-yl]methyl benzoate (PubChem CID 99692523) has the molecular formula C42H44N2O11 and a molecular weight of 752.82 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4-dibenzoyloxy-5-[6-methyl-5-[(E)-3-octoxy-3-oxoprop-1-enyl]-2,4-dioxo-1H-pyrimidin-3-yl]oxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5R)-3,4-dibenzoyloxy-5-[6-methyl-5-[(E)-3-octoxy-3-oxoprop-1-enyl]-2,4-dioxo-1H-pyrimidin-3-yl]oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 99692523 |
| Molecular Formula | C42H44N2O11 |
| Molecular Weight | 752.82 g/mol |
| Exact Mass | 752.29 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4-dibenzoyloxy-5-[6-methyl-5-[(E)-3-octoxy-3-oxoprop-1-enyl]-2,4-dioxo-1H-pyrimidin-3-yl]oxolan-2-yl]methyl benzoate |
| SMILES | CCCCCCCCOC(=O)/C=C/c1c(C)[nH]c(=O)n([C@@H]2O[C@H](COC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)[C@@H]2OC(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C42H44N2O11/c1-3-4-5-6-7-17-26-51-34(45)25-24-32-28(2)43-42(50)44(37(32)46)38-36(55-41(49)31-22-15-10-16-23-31)35(54-40(48)30-20-13-9-14-21-30)33(53-38)27-52-39(47)29-18-11-8-12-19-29/h8-16,18-25,33,35-36,38H,3-7,17,26-27H2,1-2H3,(H,43,50)/b25-24+/t33-,35+,36+,38-/m1/s1 |
| InChIKey | GPSDMFFPRIIGBF-YBVRYEMDSA-N |
| XLogP | 5.97 |
| TPSA | 169.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.82 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|