C16H16F5N3O2 — CID 99696243
N-[(3S,5S)-1-cyclopropyl-5-methylpyrrolidin-3-yl]-N'-(2,3,4,5,6-pentafluorophenyl)oxamide (PubChem CID 99696243) has the molecular formula C16H16F5N3O2 and a molecular weight of 377.31 g/mol. Its IUPAC name is N-[(3S,5S)-1-cyclopropyl-5-methylpyrrolidin-3-yl]-N'-(2,3,4,5,6-pentafluorophenyl)oxamide.
| Compound Name | N-[(3S,5S)-1-cyclopropyl-5-methylpyrrolidin-3-yl]-N'-(2,3,4,5,6-pentafluorophenyl)oxamide |
|---|---|
| PubChem CID | 99696243 |
| Molecular Formula | C16H16F5N3O2 |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-[(3S,5S)-1-cyclopropyl-5-methylpyrrolidin-3-yl]-N'-(2,3,4,5,6-pentafluorophenyl)oxamide |
| SMILES | C[C@H]1C[C@H](NC(=O)C(=O)Nc2c(F)c(F)c(F)c(F)c2F)CN1C1CC1 |
| InChI | InChI=1S/C16H16F5N3O2/c1-6-4-7(5-24(6)8-2-3-8)22-15(25)16(26)23-14-12(20)10(18)9(17)11(19)13(14)21/h6-8H,2-5H2,1H3,(H,22,25)(H,23,26)/t6-,7-/m0/s1 |
| InChIKey | YTNOOAMTAMGECK-BQBZGAKWSA-N |
| XLogP | 2.06 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|