C16H14BrClN4O — CID 99696332
4-bromo-N-[1-(3-chlorophenyl)-5-methylpyrazol-4-yl]-1-methylpyrrole-2-carboxamide (PubChem CID 99696332) has the molecular formula C16H14BrClN4O and a molecular weight of 393.67 g/mol. Its IUPAC name is 4-bromo-N-[1-(3-chlorophenyl)-5-methylpyrazol-4-yl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[1-(3-chlorophenyl)-5-methylpyrazol-4-yl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 99696332 |
| Molecular Formula | C16H14BrClN4O |
| Molecular Weight | 393.67 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 4-bromo-N-[1-(3-chlorophenyl)-5-methylpyrazol-4-yl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cc1c(NC(=O)c2cc(Br)cn2C)cnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H14BrClN4O/c1-10-14(20-16(23)15-6-11(17)9-21(15)2)8-19-22(10)13-5-3-4-12(18)7-13/h3-9H,1-2H3,(H,20,23) |
| InChIKey | MAJYIXXXOQPDKJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.67 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |