C20H20N4O2 — CID 99696534
(2R)-2-cyano-N-cyclohexyl-3-oxo-3-(4-pyrazin-2-ylphenyl)propanamide (PubChem CID 99696534) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is (2R)-2-cyano-N-cyclohexyl-3-oxo-3-(4-pyrazin-2-ylphenyl)propanamide.
| Compound Name | (2R)-2-cyano-N-cyclohexyl-3-oxo-3-(4-pyrazin-2-ylphenyl)propanamide |
|---|---|
| PubChem CID | 99696534 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (2R)-2-cyano-N-cyclohexyl-3-oxo-3-(4-pyrazin-2-ylphenyl)propanamide |
| SMILES | N#C[C@@H](C(=O)NC1CCCCC1)C(=O)c1ccc(-c2cnccn2)cc1 |
| InChI | InChI=1S/C20H20N4O2/c21-12-17(20(26)24-16-4-2-1-3-5-16)19(25)15-8-6-14(7-9-15)18-13-22-10-11-23-18/h6-11,13,16-17H,1-5H2,(H,24,26)/t17-/m1/s1 |
| InChIKey | RNEUBQPELKRYHQ-QGZVFWFLSA-N |
| XLogP | 2.91 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|