C14H27NO — CID 99696885
(3S)-4-[[(1R,6R)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]-3-methylbutan-1-ol (PubChem CID 99696885) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is (3S)-4-[[(1R,6R)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]-3-methylbutan-1-ol.
| Compound Name | (3S)-4-[[(1R,6R)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 99696885 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | (3S)-4-[[(1R,6R)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]-3-methylbutan-1-ol |
| SMILES | CC1=CCC[C@@H](C)[C@H]1CNC[C@@H](C)CCO |
| InChI | InChI=1S/C14H27NO/c1-11(7-8-16)9-15-10-14-12(2)5-4-6-13(14)3/h5,11,13-16H,4,6-10H2,1-3H3/t11-,13+,14-/m0/s1 |
| InChIKey | GAKCVXHXPKZVEE-YUTCNCBUSA-N |
| XLogP | 2.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|