C12H23N — CID 130835898
1-(2,6-dimethylcyclohex-2-en-1-yl)butan-2-amine (PubChem CID 130835898) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is 1-(2,6-dimethylcyclohex-2-en-1-yl)butan-2-amine.
| Compound Name | 1-(2,6-dimethylcyclohex-2-en-1-yl)butan-2-amine |
|---|---|
| PubChem CID | 130835898 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 1-(2,6-dimethylcyclohex-2-en-1-yl)butan-2-amine |
| SMILES | CCC(N)CC1C(C)=CCCC1C |
| InChI | InChI=1S/C12H23N/c1-4-11(13)8-12-9(2)6-5-7-10(12)3/h6,10-12H,4-5,7-8,13H2,1-3H3 |
| InChIKey | BVJSCUIVNJJLGO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|