C14H12N6O4 — CID 99701279
2-(3-nitrophenyl)-N-[(1S)-1-(1,2,4-oxadiazol-3-yl)ethyl]-1H-imidazole-5-carboxamide (PubChem CID 99701279) has the molecular formula C14H12N6O4 and a molecular weight of 328.29 g/mol. Its IUPAC name is 2-(3-nitrophenyl)-N-[(1S)-1-(1,2,4-oxadiazol-3-yl)ethyl]-1H-imidazole-5-carboxamide.
| Compound Name | 2-(3-nitrophenyl)-N-[(1S)-1-(1,2,4-oxadiazol-3-yl)ethyl]-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 99701279 |
| Molecular Formula | C14H12N6O4 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-(3-nitrophenyl)-N-[(1S)-1-(1,2,4-oxadiazol-3-yl)ethyl]-1H-imidazole-5-carboxamide |
| SMILES | C[C@H](NC(=O)c1cnc(-c2cccc([N+](=O)[O-])c2)[nH]1)c1ncon1 |
| InChI | InChI=1S/C14H12N6O4/c1-8(12-16-7-24-19-12)17-14(21)11-6-15-13(18-11)9-3-2-4-10(5-9)20(22)23/h2-8H,1H3,(H,15,18)(H,17,21)/t8-/m0/s1 |
| InChIKey | XMKAOBIYUUJNLR-QMMMGPOBSA-N |
| XLogP | 1.86 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|