C20H19N3O3 — CID 99701955
[(1S)-1-pyridin-2-ylbut-3-ynyl] (3R)-5-oxo-1-(pyridin-2-ylmethyl)pyrrolidine-3-carboxylate (PubChem CID 99701955) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is [(1S)-1-pyridin-2-ylbut-3-ynyl] (3R)-5-oxo-1-(pyridin-2-ylmethyl)pyrrolidine-3-carboxylate.
| Compound Name | [(1S)-1-pyridin-2-ylbut-3-ynyl] (3R)-5-oxo-1-(pyridin-2-ylmethyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 99701955 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | [(1S)-1-pyridin-2-ylbut-3-ynyl] (3R)-5-oxo-1-(pyridin-2-ylmethyl)pyrrolidine-3-carboxylate |
| SMILES | C#CC[C@H](OC(=O)[C@@H]1CC(=O)N(Cc2ccccn2)C1)c1ccccn1 |
| InChI | InChI=1S/C20H19N3O3/c1-2-7-18(17-9-4-6-11-22-17)26-20(25)15-12-19(24)23(13-15)14-16-8-3-5-10-21-16/h1,3-6,8-11,15,18H,7,12-14H2/t15-,18+/m1/s1 |
| InChIKey | GIBCABVFHVVLNW-QAPCUYQASA-N |
| XLogP | 2.13 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|