About 4-amino-3-fluorobenzoic acid
4-amino-3-fluorobenzoic acid (PubChem CID 9971) has the molecular formula C7H6FNO2
and a molecular weight of 155.13 g/mol. Its IUPAC name is 4-amino-3-fluorobenzoic acid.
Molecular Properties
| Compound Name | 4-amino-3-fluorobenzoic acid |
| PubChem CID | 9971 |
| Molecular Formula | C7H6FNO2 |
| Molecular Weight | 155.13 g/mol |
| Exact Mass | 155.04 |
| IUPAC Name | 4-amino-3-fluorobenzoic acid |
| SMILES | Nc1ccc(C(=O)O)cc1F |
| InChI | InChI=1S/C7H6FNO2/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,9H2,(H,10,11) |
| InChIKey | JSKXHTHMCCDEGD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.13 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-fluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-fluorobenzoic acid?
The IUPAC name of 4-amino-3-fluorobenzoic acid (CID 9971) is 4-amino-3-fluorobenzoic acid.
What is the SMILES notation for 4-amino-3-fluorobenzoic acid?
The canonical SMILES for 4-amino-3-fluorobenzoic acid is Nc1ccc(C(=O)O)cc1F.
What is the InChIKey of 4-amino-3-fluorobenzoic acid?
The InChIKey is JSKXHTHMCCDEGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6FNO2/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,9H2,(H,10,11).
What are the key properties of 4-amino-3-fluorobenzoic acid?
4-amino-3-fluorobenzoic acid has a molecular weight of 155.13 g/mol, XLogP of 1.11, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-fluorobenzoic acid is sourced from PubChem (CID 9971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).