C15H17F2N3O5 — CID 99710862
N-[2-(difluoromethoxy)-5-nitrophenyl]-5-oxa-8-azaspiro[3.5]nonane-8-carboxamide (PubChem CID 99710862) has the molecular formula C15H17F2N3O5 and a molecular weight of 357.31 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)-5-nitrophenyl]-5-oxa-8-azaspiro[3.5]nonane-8-carboxamide.
| Compound Name | N-[2-(difluoromethoxy)-5-nitrophenyl]-5-oxa-8-azaspiro[3.5]nonane-8-carboxamide |
|---|---|
| PubChem CID | 99710862 |
| Molecular Formula | C15H17F2N3O5 |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N-[2-(difluoromethoxy)-5-nitrophenyl]-5-oxa-8-azaspiro[3.5]nonane-8-carboxamide |
| SMILES | O=C(Nc1cc([N+](=O)[O-])ccc1OC(F)F)N1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C15H17F2N3O5/c16-13(17)25-12-3-2-10(20(22)23)8-11(12)18-14(21)19-6-7-24-15(9-19)4-1-5-15/h2-3,8,13H,1,4-7,9H2,(H,18,21) |
| InChIKey | BVMIMQAORNPTJX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|