C10H10BNO9 — CID 99738355
(2R,3R)-2-hydroxy-3-[hydroxy-(3-nitrophenyl)boranyl]oxybutanedioic acid (PubChem CID 99738355) has the molecular formula C10H10BNO9 and a molecular weight of 299.00 g/mol. Its IUPAC name is (2R,3R)-2-hydroxy-3-[hydroxy-(3-nitrophenyl)boranyl]oxybutanedioic acid.
| Compound Name | (2R,3R)-2-hydroxy-3-[hydroxy-(3-nitrophenyl)boranyl]oxybutanedioic acid |
|---|---|
| PubChem CID | 99738355 |
| Molecular Formula | C10H10BNO9 |
| Molecular Weight | 299.00 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | (2R,3R)-2-hydroxy-3-[hydroxy-(3-nitrophenyl)boranyl]oxybutanedioic acid |
| SMILES | O=C(O)[C@H](O)[C@@H](OB(O)c1cccc([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C10H10BNO9/c13-7(9(14)15)8(10(16)17)21-11(18)5-2-1-3-6(4-5)12(19)20/h1-4,7-8,13,18H,(H,14,15)(H,16,17)/t7-,8-/m1/s1 |
| InChIKey | QCZWQDIYECJPDB-HTQZYQBOSA-N |
| XLogP | -1.80 |
| TPSA | 167.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.00 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|