C12H21F3OSi — CID 99775097
tert-butyl-dimethyl-[2-[(3S)-3-(trifluoromethyl)cyclopropen-1-yl]ethoxy]silane (PubChem CID 99775097) has the molecular formula C12H21F3OSi and a molecular weight of 266.38 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-[(3S)-3-(trifluoromethyl)cyclopropen-1-yl]ethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2-[(3S)-3-(trifluoromethyl)cyclopropen-1-yl]ethoxy]silane |
|---|---|
| PubChem CID | 99775097 |
| Molecular Formula | C12H21F3OSi |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | tert-butyl-dimethyl-[2-[(3S)-3-(trifluoromethyl)cyclopropen-1-yl]ethoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCCC1=C[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C12H21F3OSi/c1-11(2,3)17(4,5)16-7-6-9-8-10(9)12(13,14)15/h8,10H,6-7H2,1-5H3/t10-/m0/s1 |
| InChIKey | GKJOGCLGZBWADU-JTQLQIEISA-N |
| XLogP | 4.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|