C18H28N2O4 — CID 99775994
1-[(2S)-2-(furan-2-yl)-2-hydroxypropyl]-3-[(4S)-1-oxaspiro[5.5]undecan-4-yl]urea (PubChem CID 99775994) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is 1-[(2S)-2-(furan-2-yl)-2-hydroxypropyl]-3-[(4S)-1-oxaspiro[5.5]undecan-4-yl]urea.
| Compound Name | 1-[(2S)-2-(furan-2-yl)-2-hydroxypropyl]-3-[(4S)-1-oxaspiro[5.5]undecan-4-yl]urea |
|---|---|
| PubChem CID | 99775994 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 1-[(2S)-2-(furan-2-yl)-2-hydroxypropyl]-3-[(4S)-1-oxaspiro[5.5]undecan-4-yl]urea |
| SMILES | C[C@](O)(CNC(=O)N[C@H]1CCOC2(CCCCC2)C1)c1ccco1 |
| InChI | InChI=1S/C18H28N2O4/c1-17(22,15-6-5-10-23-15)13-19-16(21)20-14-7-11-24-18(12-14)8-3-2-4-9-18/h5-6,10,14,22H,2-4,7-9,11-13H2,1H3,(H2,19,20,21)/t14-,17-/m0/s1 |
| InChIKey | VLUMOAQYEUCKMP-YOEHRIQHSA-N |
| XLogP | 2.67 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |