C20H32N2O4 — CID 99778519
(1S,6S)-N-[(2R)-2-cyclohexyl-2-hydroxyethyl]-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide (PubChem CID 99778519) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is (1S,6S)-N-[(2R)-2-cyclohexyl-2-hydroxyethyl]-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S,6S)-N-[(2R)-2-cyclohexyl-2-hydroxyethyl]-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 99778519 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (1S,6S)-N-[(2R)-2-cyclohexyl-2-hydroxyethyl]-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NC[C@H](O)C1CCCCC1)[C@H]1CC=CC[C@@H]1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C20H32N2O4/c23-18(15-6-2-1-3-7-15)14-21-19(24)16-8-4-5-9-17(16)20(25)22-10-12-26-13-11-22/h4-5,15-18,23H,1-3,6-14H2,(H,21,24)/t16-,17-,18-/m0/s1 |
| InChIKey | ADLZCFPFSRVOSM-BZSNNMDCSA-N |
| XLogP | 1.49 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|