C18H26N2O3 — CID 99829878
(1S,6S)-N-hex-5-ynyl-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide (PubChem CID 99829878) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (1S,6S)-N-hex-5-ynyl-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S,6S)-N-hex-5-ynyl-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 99829878 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (1S,6S)-N-hex-5-ynyl-6-(morpholine-4-carbonyl)cyclohex-3-ene-1-carboxamide |
| SMILES | C#CCCCCNC(=O)[C@H]1CC=CC[C@@H]1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C18H26N2O3/c1-2-3-4-7-10-19-17(21)15-8-5-6-9-16(15)18(22)20-11-13-23-14-12-20/h1,5-6,15-16H,3-4,7-14H2,(H,19,21)/t15-,16-/m0/s1 |
| InChIKey | YISVPXYEJLKAFU-HOTGVXAUSA-N |
| XLogP | 1.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|