C22H25FN2O3 — CID 99783454
1-[(3S)-4-benzyl-3-ethylpiperazin-1-yl]-2-(5-fluoro-2-methoxyphenyl)ethane-1,2-dione (PubChem CID 99783454) has the molecular formula C22H25FN2O3 and a molecular weight of 384.45 g/mol. Its IUPAC name is 1-[(3S)-4-benzyl-3-ethylpiperazin-1-yl]-2-(5-fluoro-2-methoxyphenyl)ethane-1,2-dione.
| Compound Name | 1-[(3S)-4-benzyl-3-ethylpiperazin-1-yl]-2-(5-fluoro-2-methoxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 99783454 |
| Molecular Formula | C22H25FN2O3 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1-[(3S)-4-benzyl-3-ethylpiperazin-1-yl]-2-(5-fluoro-2-methoxyphenyl)ethane-1,2-dione |
| SMILES | CC[C@H]1CN(C(=O)C(=O)c2cc(F)ccc2OC)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C22H25FN2O3/c1-3-18-15-25(12-11-24(18)14-16-7-5-4-6-8-16)22(27)21(26)19-13-17(23)9-10-20(19)28-2/h4-10,13,18H,3,11-12,14-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | XOXZLKIXINBNQJ-SFHVURJKSA-N |
| XLogP | 3.14 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|