C15H15Cl2N3O2 — CID 99785550
2,4-dichloro-N-[2-[[(1S,3R)-3-cyanocyclopentyl]amino]-2-oxoethyl]benzamide (PubChem CID 99785550) has the molecular formula C15H15Cl2N3O2 and a molecular weight of 340.21 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[[(1S,3R)-3-cyanocyclopentyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[[(1S,3R)-3-cyanocyclopentyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 99785550 |
| Molecular Formula | C15H15Cl2N3O2 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 2,4-dichloro-N-[2-[[(1S,3R)-3-cyanocyclopentyl]amino]-2-oxoethyl]benzamide |
| SMILES | N#C[C@@H]1CC[C@H](NC(=O)CNC(=O)c2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C15H15Cl2N3O2/c16-10-2-4-12(13(17)6-10)15(22)19-8-14(21)20-11-3-1-9(5-11)7-18/h2,4,6,9,11H,1,3,5,8H2,(H,19,22)(H,20,21)/t9-,11+/m1/s1 |
| InChIKey | XWZFQZTYFHXDQT-KOLCDFICSA-N |
| XLogP | 2.53 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |