C19H31NO3S — CID 99792176
[(2S)-1-[2-(4-tert-butylphenyl)sulfonylethyl]-2-methylpiperidin-2-yl]methanol (PubChem CID 99792176) has the molecular formula C19H31NO3S and a molecular weight of 353.53 g/mol. Its IUPAC name is [(2S)-1-[2-(4-tert-butylphenyl)sulfonylethyl]-2-methylpiperidin-2-yl]methanol.
| Compound Name | [(2S)-1-[2-(4-tert-butylphenyl)sulfonylethyl]-2-methylpiperidin-2-yl]methanol |
|---|---|
| PubChem CID | 99792176 |
| Molecular Formula | C19H31NO3S |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | [(2S)-1-[2-(4-tert-butylphenyl)sulfonylethyl]-2-methylpiperidin-2-yl]methanol |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)CCN2CCCC[C@@]2(C)CO)cc1 |
| InChI | InChI=1S/C19H31NO3S/c1-18(2,3)16-7-9-17(10-8-16)24(22,23)14-13-20-12-6-5-11-19(20,4)15-21/h7-10,21H,5-6,11-15H2,1-4H3/t19-/m0/s1 |
| InChIKey | WDNMCHCSBYJXDY-IBGZPJMESA-N |
| XLogP | 2.99 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |