C20H31NO5S — CID 110631615
3-(4-tert-butylphenyl)sulfonyl-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]propanamide (PubChem CID 110631615) has the molecular formula C20H31NO5S and a molecular weight of 397.54 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)sulfonyl-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]propanamide.
| Compound Name | 3-(4-tert-butylphenyl)sulfonyl-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]propanamide |
|---|---|
| PubChem CID | 110631615 |
| Molecular Formula | C20H31NO5S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 3-(4-tert-butylphenyl)sulfonyl-N-[[4-(hydroxymethyl)oxan-4-yl]methyl]propanamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)CCC(=O)NCC2(CO)CCOCC2)cc1 |
| InChI | InChI=1S/C20H31NO5S/c1-19(2,3)16-4-6-17(7-5-16)27(24,25)13-8-18(23)21-14-20(15-22)9-11-26-12-10-20/h4-7,22H,8-15H2,1-3H3,(H,21,23) |
| InChIKey | GNNPYPASLZIMFX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |