C15H16BrF3N2O3 — CID 99792845
2-[4-(3-bromophenoxy)piperidin-1-yl]-2-oxo-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 99792845) has the molecular formula C15H16BrF3N2O3 and a molecular weight of 409.20 g/mol. Its IUPAC name is 2-[4-(3-bromophenoxy)piperidin-1-yl]-2-oxo-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[4-(3-bromophenoxy)piperidin-1-yl]-2-oxo-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 99792845 |
| Molecular Formula | C15H16BrF3N2O3 |
| Molecular Weight | 409.20 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | 2-[4-(3-bromophenoxy)piperidin-1-yl]-2-oxo-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(NCC(F)(F)F)C(=O)N1CCC(Oc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C15H16BrF3N2O3/c16-10-2-1-3-12(8-10)24-11-4-6-21(7-5-11)14(23)13(22)20-9-15(17,18)19/h1-3,8,11H,4-7,9H2,(H,20,22) |
| InChIKey | DXWOZCLPJGUARW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.20 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|