C21H21ClN2O3 — CID 99796767
N-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-[(3-chlorophenyl)methoxy]-4-oxo-1H-pyridine-2-carboxamide (PubChem CID 99796767) has the molecular formula C21H21ClN2O3 and a molecular weight of 384.86 g/mol. Its IUPAC name is N-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-[(3-chlorophenyl)methoxy]-4-oxo-1H-pyridine-2-carboxamide.
| Compound Name | N-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-[(3-chlorophenyl)methoxy]-4-oxo-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 99796767 |
| Molecular Formula | C21H21ClN2O3 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | N-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-5-[(3-chlorophenyl)methoxy]-4-oxo-1H-pyridine-2-carboxamide |
| SMILES | O=C(NC[C@H]1C[C@H]2C=C[C@@H]1C2)c1cc(=O)c(OCc2cccc(Cl)c2)c[nH]1 |
| InChI | InChI=1S/C21H21ClN2O3/c22-17-3-1-2-14(8-17)12-27-20-11-23-18(9-19(20)25)21(26)24-10-16-7-13-4-5-15(16)6-13/h1-5,8-9,11,13,15-16H,6-7,10,12H2,(H,23,25)(H,24,26)/t13-,15+,16+/m0/s1 |
| InChIKey | JOQVHQKFSVTBFJ-NUEKZKHPSA-N |
| XLogP | 3.55 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|