C18H19ClN2O3 — CID 91641085
5-[(3-chlorophenyl)methoxy]-N-cyclopentyl-4-oxo-1H-pyridine-2-carboxamide (PubChem CID 91641085) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methoxy]-N-cyclopentyl-4-oxo-1H-pyridine-2-carboxamide.
| Compound Name | 5-[(3-chlorophenyl)methoxy]-N-cyclopentyl-4-oxo-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 91641085 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 5-[(3-chlorophenyl)methoxy]-N-cyclopentyl-4-oxo-1H-pyridine-2-carboxamide |
| SMILES | O=C(NC1CCCC1)c1cc(=O)c(OCc2cccc(Cl)c2)c[nH]1 |
| InChI | InChI=1S/C18H19ClN2O3/c19-13-5-3-4-12(8-13)11-24-17-10-20-15(9-16(17)22)18(23)21-14-6-1-2-7-14/h3-5,8-10,14H,1-2,6-7,11H2,(H,20,22)(H,21,23) |
| InChIKey | VBLPEJAOJPEFTQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |