C17H16ClN3O4 — CID 52903063
4-[5-[(3-chlorophenyl)methoxy]-4-oxo-1H-pyridine-2-carbonyl]piperazin-2-one (PubChem CID 52903063) has the molecular formula C17H16ClN3O4 and a molecular weight of 361.79 g/mol. Its IUPAC name is 4-[5-[(3-chlorophenyl)methoxy]-4-oxo-1H-pyridine-2-carbonyl]piperazin-2-one.
| Compound Name | 4-[5-[(3-chlorophenyl)methoxy]-4-oxo-1H-pyridine-2-carbonyl]piperazin-2-one |
|---|---|
| PubChem CID | 52903063 |
| Molecular Formula | C17H16ClN3O4 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 4-[5-[(3-chlorophenyl)methoxy]-4-oxo-1H-pyridine-2-carbonyl]piperazin-2-one |
| SMILES | O=C1CN(C(=O)c2cc(=O)c(OCc3cccc(Cl)c3)c[nH]2)CCN1 |
| InChI | InChI=1S/C17H16ClN3O4/c18-12-3-1-2-11(6-12)10-25-15-8-20-13(7-14(15)22)17(24)21-5-4-19-16(23)9-21/h1-3,6-8H,4-5,9-10H2,(H,19,23)(H,20,22) |
| InChIKey | ASASNIGGHOGSOM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |