C21H16Cl2N2O3 — CID 58064791
4-[4,5-bis(3-chlorophenyl)furan-2-carbonyl]piperazin-2-one (PubChem CID 58064791) has the molecular formula C21H16Cl2N2O3 and a molecular weight of 415.28 g/mol. Its IUPAC name is 4-[4,5-bis(3-chlorophenyl)furan-2-carbonyl]piperazin-2-one.
| Compound Name | 4-[4,5-bis(3-chlorophenyl)furan-2-carbonyl]piperazin-2-one |
|---|---|
| PubChem CID | 58064791 |
| Molecular Formula | C21H16Cl2N2O3 |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | 4-[4,5-bis(3-chlorophenyl)furan-2-carbonyl]piperazin-2-one |
| SMILES | O=C1CN(C(=O)c2cc(-c3cccc(Cl)c3)c(-c3cccc(Cl)c3)o2)CCN1 |
| InChI | InChI=1S/C21H16Cl2N2O3/c22-15-5-1-3-13(9-15)17-11-18(21(27)25-8-7-24-19(26)12-25)28-20(17)14-4-2-6-16(23)10-14/h1-6,9-11H,7-8,12H2,(H,24,26) |
| InChIKey | WPHDDERNRQBIDP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |