C21H17FN2O3 — CID 46832587
4-[5-(4-fluorophenyl)-4-phenylfuran-2-carbonyl]piperazin-2-one (PubChem CID 46832587) has the molecular formula C21H17FN2O3 and a molecular weight of 364.38 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)-4-phenylfuran-2-carbonyl]piperazin-2-one.
| Compound Name | 4-[5-(4-fluorophenyl)-4-phenylfuran-2-carbonyl]piperazin-2-one |
|---|---|
| PubChem CID | 46832587 |
| Molecular Formula | C21H17FN2O3 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 4-[5-(4-fluorophenyl)-4-phenylfuran-2-carbonyl]piperazin-2-one |
| SMILES | O=C1CN(C(=O)c2cc(-c3ccccc3)c(-c3ccc(F)cc3)o2)CCN1 |
| InChI | InChI=1S/C21H17FN2O3/c22-16-8-6-15(7-9-16)20-17(14-4-2-1-3-5-14)12-18(27-20)21(26)24-11-10-23-19(25)13-24/h1-9,12H,10-11,13H2,(H,23,25) |
| InChIKey | IMRPLEUNZURSJD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |