C21H15Cl2FN2O3 — CID 46832879
4-[4-(5-chloro-2-fluorophenyl)-5-(3-chlorophenyl)furan-2-carbonyl]piperazin-2-one (PubChem CID 46832879) has the molecular formula C21H15Cl2FN2O3 and a molecular weight of 433.27 g/mol. Its IUPAC name is 4-[4-(5-chloro-2-fluorophenyl)-5-(3-chlorophenyl)furan-2-carbonyl]piperazin-2-one.
| Compound Name | 4-[4-(5-chloro-2-fluorophenyl)-5-(3-chlorophenyl)furan-2-carbonyl]piperazin-2-one |
|---|---|
| PubChem CID | 46832879 |
| Molecular Formula | C21H15Cl2FN2O3 |
| Molecular Weight | 433.27 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | 4-[4-(5-chloro-2-fluorophenyl)-5-(3-chlorophenyl)furan-2-carbonyl]piperazin-2-one |
| SMILES | O=C1CN(C(=O)c2cc(-c3cc(Cl)ccc3F)c(-c3cccc(Cl)c3)o2)CCN1 |
| InChI | InChI=1S/C21H15Cl2FN2O3/c22-13-3-1-2-12(8-13)20-16(15-9-14(23)4-5-17(15)24)10-18(29-20)21(28)26-7-6-25-19(27)11-26/h1-5,8-10H,6-7,11H2,(H,25,27) |
| InChIKey | YDFZOPRRLMQHON-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.27 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |