C22H26ClN5O2 — CID 111305731
1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine (PubChem CID 111305731) has the molecular formula C22H26ClN5O2 and a molecular weight of 427.94 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111305731 |
| Molecular Formula | C22H26ClN5O2 |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(C(=O)N2CCNC(=O)C2)cc1)N(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H26ClN5O2/c1-24-22(27(2)14-17-4-3-5-19(23)12-17)26-13-16-6-8-18(9-7-16)21(30)28-11-10-25-20(29)15-28/h3-9,12H,10-11,13-15H2,1-2H3,(H,24,26)(H,25,29) |
| InChIKey | MZYJVOSPTXCXCE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|