C20H30IN5O2 — CID 109495828
1,2-dimethyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]-1-pent-4-enylguanidine;hydroiodide (PubChem CID 109495828) has the molecular formula C20H30IN5O2 and a molecular weight of 499.40 g/mol. Its IUPAC name is 1,2-dimethyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]-1-pent-4-enylguanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]-1-pent-4-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109495828 |
| Molecular Formula | C20H30IN5O2 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 1,2-dimethyl-3-[[4-(3-oxopiperazine-1-carbonyl)phenyl]methyl]-1-pent-4-enylguanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N\C)NCc1ccc(C(=O)N2CCNC(=O)C2)cc1.I |
| InChI | InChI=1S/C20H29N5O2.HI/c1-4-5-6-12-24(3)20(21-2)23-14-16-7-9-17(10-8-16)19(27)25-13-11-22-18(26)15-25;/h4,7-10H,1,5-6,11-15H2,2-3H3,(H,21,23)(H,22,26);1H |
| InChIKey | UODUGQLWFBSOGD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|