C19H30IN5O — CID 109496597
1,2-dimethyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-1-pent-4-enylguanidine;hydroiodide (PubChem CID 109496597) has the molecular formula C19H30IN5O and a molecular weight of 471.39 g/mol. Its IUPAC name is 1,2-dimethyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-1-pent-4-enylguanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-1-pent-4-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109496597 |
| Molecular Formula | C19H30IN5O |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 1,2-dimethyl-3-[[4-(3-oxopiperazin-1-yl)phenyl]methyl]-1-pent-4-enylguanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N\C)NCc1ccc(N2CCNC(=O)C2)cc1.I |
| InChI | InChI=1S/C19H29N5O.HI/c1-4-5-6-12-23(3)19(20-2)22-14-16-7-9-17(10-8-16)24-13-11-21-18(25)15-24;/h4,7-10H,1,5-6,11-15H2,2-3H3,(H,20,22)(H,21,25);1H |
| InChIKey | QFSDUTMLBCWHIP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|