About N-(2,2-difluoroethyl)-N-(4-fluorophenyl)quinoline-5-sulfonamide
N-(2,2-difluoroethyl)-N-(4-fluorophenyl)quinoline-5-sulfonamide (PubChem CID 99801739) has the molecular formula C17H13F3N2O2S
and a molecular weight of 366.36 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N-(4-fluorophenyl)quinoline-5-sulfonamide.
Molecular Properties
| Compound Name | N-(2,2-difluoroethyl)-N-(4-fluorophenyl)quinoline-5-sulfonamide |
| PubChem CID | 99801739 |
| Molecular Formula | C17H13F3N2O2S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | N-(2,2-difluoroethyl)-N-(4-fluorophenyl)quinoline-5-sulfonamide |
| SMILES | O=S(=O)(c1cccc2ncccc12)N(CC(F)F)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H13F3N2O2S/c18-12-6-8-13(9-7-12)22(11-17(19)20)25(23,24)16-5-1-4-15-14(16)3-2-10-21-15/h1-10,17H,11H2 |
| InChIKey | ORUYNLGHXMVZBD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,2-difluoroethyl)-N-(4-fluorophenyl)quinoline-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoroethyl)-N-(4-fluorophenyl)quinoline-5-sulfonamide?
The IUPAC name of N-(2,2-difluoroethyl)-N-(4-fluorophenyl)quinoline-5-sulfonamide (CID 99801739) is N-(2,2-difluoroethyl)-N-(4-fluorophenyl)quinoline-5-sulfonamide.
What is the SMILES notation for N-(2,2-difluoroethyl)-N-(4-fluorophenyl)quinoline-5-sulfonamide?
The canonical SMILES for N-(2,2-difluoroethyl)-N-(4-fluorophenyl)quinoline-5-sulfonamide is O=S(=O)(c1cccc2ncccc12)N(CC(F)F)c1ccc(F)cc1.
What is the InChIKey of N-(2,2-difluoroethyl)-N-(4-fluorophenyl)quinoline-5-sulfonamide?
The InChIKey is ORUYNLGHXMVZBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F3N2O2S/c18-12-6-8-13(9-7-12)22(11-17(19)20)25(23,24)16-5-1-4-15-14(16)3-2-10-21-15/h1-10,17H,11H2.
What are the key properties of N-(2,2-difluoroethyl)-N-(4-fluorophenyl)quinoline-5-sulfonamide?
N-(2,2-difluoroethyl)-N-(4-fluorophenyl)quinoline-5-sulfonamide has a molecular weight of 366.36 g/mol, XLogP of 3.83, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoroethyl)-N-(4-fluorophenyl)quinoline-5-sulfonamide is sourced from PubChem (CID 99801739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).