C25H27BrN2O3S2 — CID 99807988
(2S)-2-(4-bromophenyl)sulfanyl-N-[4-[(4-butylphenyl)sulfamoyl]phenyl]propanamide (PubChem CID 99807988) has the molecular formula C25H27BrN2O3S2 and a molecular weight of 547.54 g/mol. Its IUPAC name is (2S)-2-(4-bromophenyl)sulfanyl-N-[4-[(4-butylphenyl)sulfamoyl]phenyl]propanamide.
| Compound Name | (2S)-2-(4-bromophenyl)sulfanyl-N-[4-[(4-butylphenyl)sulfamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 99807988 |
| Molecular Formula | C25H27BrN2O3S2 |
| Molecular Weight | 547.54 g/mol |
| Exact Mass | 546.06 |
| IUPAC Name | (2S)-2-(4-bromophenyl)sulfanyl-N-[4-[(4-butylphenyl)sulfamoyl]phenyl]propanamide |
| SMILES | CCCCc1ccc(NS(=O)(=O)c2ccc(NC(=O)[C@H](C)Sc3ccc(Br)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H27BrN2O3S2/c1-3-4-5-19-6-10-22(11-7-19)28-33(30,31)24-16-12-21(13-17-24)27-25(29)18(2)32-23-14-8-20(26)9-15-23/h6-18,28H,3-5H2,1-2H3,(H,27,29)/t18-/m0/s1 |
| InChIKey | SVWOSLVIEVREPQ-SFHVURJKSA-N |
| XLogP | 6.71 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.54 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |