C20H23F3N2O2 — CID 99808104
N-[2-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-2-oxoethyl]-4-(trifluoromethyl)benzamide (PubChem CID 99808104) has the molecular formula C20H23F3N2O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is N-[2-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-2-oxoethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-2-oxoethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 99808104 |
| Molecular Formula | C20H23F3N2O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-[2-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-2-oxoethyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NCC(=O)N1CCC[C@]2(CC=CCC2)C1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H23F3N2O2/c21-20(22,23)16-7-5-15(6-8-16)18(27)24-13-17(26)25-12-4-11-19(14-25)9-2-1-3-10-19/h1-2,5-8H,3-4,9-14H2,(H,24,27)/t19-/m1/s1 |
| InChIKey | TVSWLXBHQQVLMT-LJQANCHMSA-N |
| XLogP | 3.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|