C18H22N2OS — CID 99808151
3-[[(6S)-2-azaspiro[5.5]undec-9-en-2-yl]methyl]-5-thiophen-2-yl-1,2-oxazole (PubChem CID 99808151) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is 3-[[(6S)-2-azaspiro[5.5]undec-9-en-2-yl]methyl]-5-thiophen-2-yl-1,2-oxazole.
| Compound Name | 3-[[(6S)-2-azaspiro[5.5]undec-9-en-2-yl]methyl]-5-thiophen-2-yl-1,2-oxazole |
|---|---|
| PubChem CID | 99808151 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 3-[[(6S)-2-azaspiro[5.5]undec-9-en-2-yl]methyl]-5-thiophen-2-yl-1,2-oxazole |
| SMILES | C1=CC[C@]2(CC1)CCCN(Cc1cc(-c3cccs3)on1)C2 |
| InChI | InChI=1S/C18H22N2OS/c1-2-7-18(8-3-1)9-5-10-20(14-18)13-15-12-16(21-19-15)17-6-4-11-22-17/h1-2,4,6,11-12H,3,5,7-10,13-14H2/t18-/m0/s1 |
| InChIKey | FKGITLWUKUNCEV-SFHVURJKSA-N |
| XLogP | 4.73 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|