C17H18FN3 — CID 99809980
2-cyclopropyl-N-[[1-(3-fluorophenyl)cyclopropyl]methyl]pyrimidin-4-amine (PubChem CID 99809980) has the molecular formula C17H18FN3 and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-cyclopropyl-N-[[1-(3-fluorophenyl)cyclopropyl]methyl]pyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-N-[[1-(3-fluorophenyl)cyclopropyl]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 99809980 |
| Molecular Formula | C17H18FN3 |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 2-cyclopropyl-N-[[1-(3-fluorophenyl)cyclopropyl]methyl]pyrimidin-4-amine |
| SMILES | Fc1cccc(C2(CNc3ccnc(C4CC4)n3)CC2)c1 |
| InChI | InChI=1S/C17H18FN3/c18-14-3-1-2-13(10-14)17(7-8-17)11-20-15-6-9-19-16(21-15)12-4-5-12/h1-3,6,9-10,12H,4-5,7-8,11H2,(H,19,20,21) |
| InChIKey | UDZLHXNWGGTSKS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |