C18H18N2O3 — CID 99813983
(2S,4R)-4-(1-benzofuran-2-yl)-3-oxo-2-(pyrrolidine-1-carbonyl)pentanenitrile (PubChem CID 99813983) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is (2S,4R)-4-(1-benzofuran-2-yl)-3-oxo-2-(pyrrolidine-1-carbonyl)pentanenitrile.
| Compound Name | (2S,4R)-4-(1-benzofuran-2-yl)-3-oxo-2-(pyrrolidine-1-carbonyl)pentanenitrile |
|---|---|
| PubChem CID | 99813983 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | (2S,4R)-4-(1-benzofuran-2-yl)-3-oxo-2-(pyrrolidine-1-carbonyl)pentanenitrile |
| SMILES | C[C@@H](C(=O)[C@H](C#N)C(=O)N1CCCC1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C18H18N2O3/c1-12(16-10-13-6-2-3-7-15(13)23-16)17(21)14(11-19)18(22)20-8-4-5-9-20/h2-3,6-7,10,12,14H,4-5,8-9H2,1H3/t12-,14+/m1/s1 |
| InChIKey | BLNXXEAAIRNYDH-OCCSQVGLSA-N |
| XLogP | 2.87 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|