C12H21F3N2O2S — CID 99832212
(5S)-5-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]-1,4-thiazepane-4-carboxamide (PubChem CID 99832212) has the molecular formula C12H21F3N2O2S and a molecular weight of 314.37 g/mol. Its IUPAC name is (5S)-5-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]-1,4-thiazepane-4-carboxamide.
| Compound Name | (5S)-5-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]-1,4-thiazepane-4-carboxamide |
|---|---|
| PubChem CID | 99832212 |
| Molecular Formula | C12H21F3N2O2S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (5S)-5-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]-1,4-thiazepane-4-carboxamide |
| SMILES | C[C@H]1CCSCCN1C(=O)NCCCOCC(F)(F)F |
| InChI | InChI=1S/C12H21F3N2O2S/c1-10-3-7-20-8-5-17(10)11(18)16-4-2-6-19-9-12(13,14)15/h10H,2-9H2,1H3,(H,16,18)/t10-/m0/s1 |
| InChIKey | LXBULIQGRSOJNV-JTQLQIEISA-N |
| XLogP | 2.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|