C13H16N2O2 — CID 99833738
1-(2,3-dihydro-1-benzofuran-5-ylmethylamino)cyclopropane-1-carboxamide (PubChem CID 99833738) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-ylmethylamino)cyclopropane-1-carboxamide.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-ylmethylamino)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 99833738 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-ylmethylamino)cyclopropane-1-carboxamide |
| SMILES | NC(=O)C1(NCc2ccc3c(c2)CCO3)CC1 |
| InChI | InChI=1S/C13H16N2O2/c14-12(16)13(4-5-13)15-8-9-1-2-11-10(7-9)3-6-17-11/h1-2,7,15H,3-6,8H2,(H2,14,16) |
| InChIKey | BKONOBABSCLGPE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|