C12H12FN3OS — CID 99840259
1-(3-fluoro-2-pyridinyl)-3-[(1S)-1-thiophen-2-ylethyl]urea (PubChem CID 99840259) has the molecular formula C12H12FN3OS and a molecular weight of 265.31 g/mol. Its IUPAC name is 1-(3-fluoro-2-pyridinyl)-3-[(1S)-1-thiophen-2-ylethyl]urea.
| Compound Name | 1-(3-fluoro-2-pyridinyl)-3-[(1S)-1-thiophen-2-ylethyl]urea |
|---|---|
| PubChem CID | 99840259 |
| Molecular Formula | C12H12FN3OS |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 1-(3-fluoro-2-pyridinyl)-3-[(1S)-1-thiophen-2-ylethyl]urea |
| SMILES | C[C@H](NC(=O)Nc1ncccc1F)c1cccs1 |
| InChI | InChI=1S/C12H12FN3OS/c1-8(10-5-3-7-18-10)15-12(17)16-11-9(13)4-2-6-14-11/h2-8H,1H3,(H2,14,15,16,17)/t8-/m0/s1 |
| InChIKey | YKRURVJMAUILTN-QMMMGPOBSA-N |
| XLogP | 3.16 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |