C18H23N3O2 — CID 99840950
1-[(1S)-1-[(2R)-oxolan-2-yl]propyl]-3-(quinolin-6-ylmethyl)urea (PubChem CID 99840950) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-[(1S)-1-[(2R)-oxolan-2-yl]propyl]-3-(quinolin-6-ylmethyl)urea.
| Compound Name | 1-[(1S)-1-[(2R)-oxolan-2-yl]propyl]-3-(quinolin-6-ylmethyl)urea |
|---|---|
| PubChem CID | 99840950 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-[(1S)-1-[(2R)-oxolan-2-yl]propyl]-3-(quinolin-6-ylmethyl)urea |
| SMILES | CC[C@H](NC(=O)NCc1ccc2ncccc2c1)[C@H]1CCCO1 |
| InChI | InChI=1S/C18H23N3O2/c1-2-15(17-6-4-10-23-17)21-18(22)20-12-13-7-8-16-14(11-13)5-3-9-19-16/h3,5,7-9,11,15,17H,2,4,6,10,12H2,1H3,(H2,20,21,22)/t15-,17+/m0/s1 |
| InChIKey | RXYJCGMQXSQMRV-DOTOQJQBSA-N |
| XLogP | 2.99 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |