C17H20O4 — CID 99844914
2,2-dimethyl-5-[(1R,2R,3S,5R,6R,7R,8S,9R,10R)-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanyl]-1,3-dioxane-4,6-dione (PubChem CID 99844914) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is 2,2-dimethyl-5-[(1R,2R,3S,5R,6R,7R,8S,9R,10R)-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanyl]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[(1R,2R,3S,5R,6R,7R,8S,9R,10R)-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanyl]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 99844914 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2,2-dimethyl-5-[(1R,2R,3S,5R,6R,7R,8S,9R,10R)-8-pentacyclo[5.4.0.02,6.03,10.05,9]undecanyl]-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C([C@H]2[C@@H]3[C@@H]4C[C@@H]5[C@H]6[C@H]4C[C@H]3[C@H]6[C@@H]52)C(=O)O1 |
| InChI | InChI=1S/C17H20O4/c1-17(2)20-15(18)14(16(19)21-17)13-10-6-4-7-9-5(6)3-8(10)11(9)12(7)13/h5-14H,3-4H2,1-2H3/t5-,6+,7+,8+,9+,10+,11+,12+,13-/m0/s1 |
| InChIKey | JHFQCKGGHXOIDZ-GRIDJURNSA-N |
| XLogP | 1.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|