C15H20Cl2N2OS — CID 99849859
N-[2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]phenyl]-4-(methylamino)butanamide (PubChem CID 99849859) has the molecular formula C15H20Cl2N2OS and a molecular weight of 347.31 g/mol. Its IUPAC name is N-[2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]phenyl]-4-(methylamino)butanamide.
| Compound Name | N-[2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]phenyl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 99849859 |
| Molecular Formula | C15H20Cl2N2OS |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | N-[2-[[(1R)-2,2-dichlorocyclopropyl]methylsulfanyl]phenyl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)Nc1ccccc1SC[C@H]1CC1(Cl)Cl |
| InChI | InChI=1S/C15H20Cl2N2OS/c1-18-8-4-7-14(20)19-12-5-2-3-6-13(12)21-10-11-9-15(11,16)17/h2-3,5-6,11,18H,4,7-10H2,1H3,(H,19,20)/t11-/m1/s1 |
| InChIKey | HGDHFRGLTCUHHH-LLVKDONJSA-N |
| XLogP | 3.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|