C19H19Cl2FN2O2S — CID 78893729
1-[2-[(2,2-dichlorocyclopropyl)methylsulfanyl]phenyl]-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea (PubChem CID 78893729) has the molecular formula C19H19Cl2FN2O2S and a molecular weight of 429.34 g/mol. Its IUPAC name is 1-[2-[(2,2-dichlorocyclopropyl)methylsulfanyl]phenyl]-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea.
| Compound Name | 1-[2-[(2,2-dichlorocyclopropyl)methylsulfanyl]phenyl]-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 78893729 |
| Molecular Formula | C19H19Cl2FN2O2S |
| Molecular Weight | 429.34 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 1-[2-[(2,2-dichlorocyclopropyl)methylsulfanyl]phenyl]-3-[2-(4-fluorophenyl)-2-hydroxyethyl]urea |
| SMILES | O=C(NCC(O)c1ccc(F)cc1)Nc1ccccc1SCC1CC1(Cl)Cl |
| InChI | InChI=1S/C19H19Cl2FN2O2S/c20-19(21)9-13(19)11-27-17-4-2-1-3-15(17)24-18(26)23-10-16(25)12-5-7-14(22)8-6-12/h1-8,13,16,25H,9-11H2,(H2,23,24,26) |
| InChIKey | SXMUKUDXWLOUIE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.34 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|