C18H23Cl2N3O2S — CID 78893750
1-[2-[(2,2-dichlorocyclopropyl)methylsulfanyl]phenyl]-3-(2-oxo-2-piperidin-1-ylethyl)urea (PubChem CID 78893750) has the molecular formula C18H23Cl2N3O2S and a molecular weight of 416.37 g/mol. Its IUPAC name is 1-[2-[(2,2-dichlorocyclopropyl)methylsulfanyl]phenyl]-3-(2-oxo-2-piperidin-1-ylethyl)urea.
| Compound Name | 1-[2-[(2,2-dichlorocyclopropyl)methylsulfanyl]phenyl]-3-(2-oxo-2-piperidin-1-ylethyl)urea |
|---|---|
| PubChem CID | 78893750 |
| Molecular Formula | C18H23Cl2N3O2S |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 1-[2-[(2,2-dichlorocyclopropyl)methylsulfanyl]phenyl]-3-(2-oxo-2-piperidin-1-ylethyl)urea |
| SMILES | O=C(NCC(=O)N1CCCCC1)Nc1ccccc1SCC1CC1(Cl)Cl |
| InChI | InChI=1S/C18H23Cl2N3O2S/c19-18(20)10-13(18)12-26-15-7-3-2-6-14(15)22-17(25)21-11-16(24)23-8-4-1-5-9-23/h2-3,6-7,13H,1,4-5,8-12H2,(H2,21,22,25) |
| InChIKey | FVGULGYORJSAGB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|