C25H23Cl2NO3 — CID 99866819
5-chloro-N-[2-chloro-5-[(1S,2R)-2-phenylcyclohexyl]oxyphenyl]-2-hydroxybenzamide (PubChem CID 99866819) has the molecular formula C25H23Cl2NO3 and a molecular weight of 456.37 g/mol. Its IUPAC name is 5-chloro-N-[2-chloro-5-[(1S,2R)-2-phenylcyclohexyl]oxyphenyl]-2-hydroxybenzamide.
| Compound Name | 5-chloro-N-[2-chloro-5-[(1S,2R)-2-phenylcyclohexyl]oxyphenyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 99866819 |
| Molecular Formula | C25H23Cl2NO3 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 5-chloro-N-[2-chloro-5-[(1S,2R)-2-phenylcyclohexyl]oxyphenyl]-2-hydroxybenzamide |
| SMILES | O=C(Nc1cc(O[C@H]2CCCC[C@@H]2c2ccccc2)ccc1Cl)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C25H23Cl2NO3/c26-17-10-13-23(29)20(14-17)25(30)28-22-15-18(11-12-21(22)27)31-24-9-5-4-8-19(24)16-6-2-1-3-7-16/h1-3,6-7,10-15,19,24,29H,4-5,8-9H2,(H,28,30)/t19-,24+/m1/s1 |
| InChIKey | PJGPAVGDOOUJCK-DVECYGJZSA-N |
| XLogP | 7.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |