C21H18N2 — CID 99904395
4-[(Z)-2-(1H-indol-3-yl)ethenyl]-7,8-dimethylquinoline (PubChem CID 99904395) has the molecular formula C21H18N2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 4-[(Z)-2-(1H-indol-3-yl)ethenyl]-7,8-dimethylquinoline.
| Compound Name | 4-[(Z)-2-(1H-indol-3-yl)ethenyl]-7,8-dimethylquinoline |
|---|---|
| PubChem CID | 99904395 |
| Molecular Formula | C21H18N2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 4-[(Z)-2-(1H-indol-3-yl)ethenyl]-7,8-dimethylquinoline |
| SMILES | Cc1ccc2c(/C=C\c3c[nH]c4ccccc34)ccnc2c1C |
| InChI | InChI=1S/C21H18N2/c1-14-7-10-19-16(11-12-22-21(19)15(14)2)8-9-17-13-23-20-6-4-3-5-18(17)20/h3-13,23H,1-2H3/b9-8- |
| InChIKey | RQMJJSJJJVSQOZ-HJWRWDBZSA-N |
| XLogP | 5.50 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |