C17H17N3O3S — CID 99935162
N-benzyl-4-cyano-N-[(3S)-1,1-dioxothiolan-3-yl]-1H-pyrrole-2-carboxamide (PubChem CID 99935162) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is N-benzyl-4-cyano-N-[(3S)-1,1-dioxothiolan-3-yl]-1H-pyrrole-2-carboxamide.
| Compound Name | N-benzyl-4-cyano-N-[(3S)-1,1-dioxothiolan-3-yl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 99935162 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | N-benzyl-4-cyano-N-[(3S)-1,1-dioxothiolan-3-yl]-1H-pyrrole-2-carboxamide |
| SMILES | N#Cc1c[nH]c(C(=O)N(Cc2ccccc2)[C@H]2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C17H17N3O3S/c18-9-14-8-16(19-10-14)17(21)20(11-13-4-2-1-3-5-13)15-6-7-24(22,23)12-15/h1-5,8,10,15,19H,6-7,11-12H2/t15-/m0/s1 |
| InChIKey | LBLPDHNJMVFSDI-HNNXBMFYSA-N |
| XLogP | 1.72 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |